CAS 1203685-14-6 appears in our catalog under these names: 3-(3-Fluorophenyl)azetidine hydrochloride, 97%, 3-(3-Fluorophenyl)azetidine hydrochloride, 3-(3-fluorophenyl)azetidine hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg, 500mg.
3-(3-fluorophenyl)azetidine;hydrochloride (CAS 1203685-14-6) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 3-(3-fluorophenyl)azetidine;hydrochloride. InChIKey: WAFIFEIYQGLWNV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 3-(3-fluorophenyl)azetidine;hydrochloride |
| InChIKey | WAFIFEIYQGLWNV-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)