CAS 1203686-59-2 appears in our catalog under these names: 4–(Trifluoromethyl)isoindoline hydrochloride, 4-(Trifluoromethyl)isoindoline HCl 95%, 4-(Trifluoromethyl)isoindoline hydrochloride, 95%, 95%, 4-(TRIFLUOROMETHYL)ISOINDOLINE HYDROCHLORIDE, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride (CAS 1203686-59-2) is a chemical compound with the molecular formula C9H9ClF3N and a molecular weight of 223.62 g/mol. IUPAC name: 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride. InChIKey: XTPDOTXDUZRPAQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClF3N |
|---|---|
| Molecular weight | 223.62 g/mol |
| IUPAC name | 4-(trifluoromethyl)-2,3-dihydro-1H-isoindole;hydrochloride |
| InChIKey | XTPDOTXDUZRPAQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)