Products 1203686-74-1
CAS 1203686-74-1 is the registry number for 4-(Piperidin-2-yl)aniline dihydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-piperidin-2-ylaniline;dihydrochloride (CAS 1203686-74-1) is a chemical compound with the molecular formula C11H18Cl2N2 and a molecular weight of 249.18 g/mol. IUPAC name: 4-piperidin-2-ylaniline;dihydrochloride. InChIKey: OZPCATIYICQANT-UHFFFAOYSA-N.
| Molecular formula | C11H18Cl2N2 |
|---|---|
| Molecular weight | 249.18 g/mol |
| IUPAC name | 4-piperidin-2-ylaniline;dihydrochloride |
| InChIKey | OZPCATIYICQANT-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC=C(C=C2)N.Cl.Cl |
Computed by PubChem (NCBI)