CAS 1203796-57-9 appears in our catalog under these names: 3-(Azetidin-3-yl)benzonitrile, 95%, 3-(Azetidin-3-yl)benzonitrile hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
3-(azetidin-3-yl)benzonitrile;hydrochloride (CAS 1203796-57-9) is a chemical compound with the molecular formula C10H11ClN2 and a molecular weight of 194.66 g/mol. IUPAC name: 3-(azetidin-3-yl)benzonitrile;hydrochloride. InChIKey: LDPLJWPMVCJGBK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2 |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 3-(azetidin-3-yl)benzonitrile;hydrochloride |
| InChIKey | LDPLJWPMVCJGBK-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=CC(=C2)C#N.Cl |
Computed by PubChem (NCBI)