CAS 1204295-85-1 is the registry number for 1-(Bromomethyl)-4-(1,1,1-trifluoropropan-2-yl)benzene. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(bromomethyl)-4-(1,1,1-trifluoropropan-2-yl)benzene (CAS 1204295-85-1) is a chemical compound with the molecular formula C10H10BrF3 and a molecular weight of 267.08 g/mol. IUPAC name: 1-(bromomethyl)-4-(1,1,1-trifluoropropan-2-yl)benzene. InChIKey: VFPRVIMDPZDJIA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-(bromomethyl)-4-(1,1,1-trifluoropropan-2-yl)benzene |
| InChIKey | VFPRVIMDPZDJIA-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)CBr)C(F)(F)F |
Computed by PubChem (NCBI)