CAS 1225380-05-1 appears in our catalog under these names: 1-Bromo-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene, 95%, 1-Bromo-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-bromo-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene (CAS 1225380-05-1) is a chemical compound with the molecular formula C10H10BrF3 and a molecular weight of 267.08 g/mol. IUPAC name: 1-bromo-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene. InChIKey: LCCQUAUGYNBEHE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-bromo-4-(1,1,1-trifluoro-2-methylpropan-2-yl)benzene |
| InChIKey | LCCQUAUGYNBEHE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)