Products 1369928-03-9
CAS 1369928-03-9 is the registry number for 1-Bromo-3-isopropyl-5-(trifluoromethyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-propan-2-yl-5-(trifluoromethyl)benzene (CAS 1369928-03-9) is a chemical compound with the molecular formula C10H10BrF3 and a molecular weight of 267.08 g/mol. IUPAC name: 1-bromo-3-propan-2-yl-5-(trifluoromethyl)benzene. InChIKey: BJRCFRRGVMAXOF-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-bromo-3-propan-2-yl-5-(trifluoromethyl)benzene |
| InChIKey | BJRCFRRGVMAXOF-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)