Products 1416980-64-7
CAS 1416980-64-7 is the registry number for 1-(1-Bromo-2,2,2-trifluoroethyl)-3,5-dimethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(1-bromo-2,2,2-trifluoroethyl)-3,5-dimethylbenzene (CAS 1416980-64-7) is a chemical compound with the molecular formula C10H10BrF3 and a molecular weight of 267.08 g/mol. IUPAC name: 1-(1-bromo-2,2,2-trifluoroethyl)-3,5-dimethylbenzene. InChIKey: QTBLDSCJSSCIHO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-(1-bromo-2,2,2-trifluoroethyl)-3,5-dimethylbenzene |
| InChIKey | QTBLDSCJSSCIHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C(F)(F)F)Br)C |
Computed by PubChem (NCBI)