CAS 1204811-35-7 appears in our catalog under these names: 3,4-Dichloro-5,8-difluoroquinoline, 95%, 3,4-Dichloro-5,8-difluoroquinoline, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,4-dichloro-5,8-difluoroquinoline (CAS 1204811-35-7) is a chemical compound with the molecular formula C9H3Cl2F2N and a molecular weight of 234.03 g/mol. IUPAC name: 3,4-dichloro-5,8-difluoroquinoline. InChIKey: GBPNKZHOKVOISW-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F2N |
|---|---|
| Molecular weight | 234.03 g/mol |
| IUPAC name | 3,4-dichloro-5,8-difluoroquinoline |
| InChIKey | GBPNKZHOKVOISW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)C(=C(C=N2)Cl)Cl)F |
Computed by PubChem (NCBI)