CAS 2090448-66-9 is the registry number for 1,3-Dichloro-5,7-difluoroisoquinoline, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-5,7-difluoroisoquinoline (CAS 2090448-66-9) is a chemical compound with the molecular formula C9H3Cl2F2N and a molecular weight of 234.03 g/mol. IUPAC name: 1,3-dichloro-5,7-difluoroisoquinoline. InChIKey: MLYITIAQOVCPII-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F2N |
|---|---|
| Molecular weight | 234.03 g/mol |
| IUPAC name | 1,3-dichloro-5,7-difluoroisoquinoline |
| InChIKey | MLYITIAQOVCPII-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=CC(=NC(=C21)Cl)Cl)F)F |
Computed by PubChem (NCBI)