CAS 2092310-58-0 appears in our catalog under these names: 1,3-Dichloro-6,7-difluoroisoquinoline, 95%, 1,3-Dichloro-6,7-difluoroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,3-dichloro-6,7-difluoroisoquinoline (CAS 2092310-58-0) is a chemical compound with the molecular formula C9H3Cl2F2N and a molecular weight of 234.03 g/mol. IUPAC name: 1,3-dichloro-6,7-difluoroisoquinoline. InChIKey: JRSKRLWSJBZGFW-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F2N |
|---|---|
| Molecular weight | 234.03 g/mol |
| IUPAC name | 1,3-dichloro-6,7-difluoroisoquinoline |
| InChIKey | JRSKRLWSJBZGFW-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=C(C2=CC(=C1F)F)Cl)Cl |
Computed by PubChem (NCBI)