CAS 1504724-89-3 appears in our catalog under these names: 2,4-Dichloro-6,8-difluoroquinoline, 95%, 2,4-Dichloro-6,8-difluoroquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,4-dichloro-6,8-difluoroquinoline (CAS 1504724-89-3) is a chemical compound with the molecular formula C9H3Cl2F2N and a molecular weight of 234.03 g/mol. IUPAC name: 2,4-dichloro-6,8-difluoroquinoline. InChIKey: PNBDSTJFDOBYCB-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F2N |
|---|---|
| Molecular weight | 234.03 g/mol |
| IUPAC name | 2,4-dichloro-6,8-difluoroquinoline |
| InChIKey | PNBDSTJFDOBYCB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CC(=N2)Cl)Cl)F)F |
Computed by PubChem (NCBI)