CAS 120523-13-9 appears in our catalog under these names: (1R)-1-(2,5-Dimethoxyphenyl)ethan-1-ol, 95%, (1R)-1-(2,5-Dimethoxyphenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
(1R)-1-(2,5-dimethoxyphenyl)ethanol (CAS 120523-13-9) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: (1R)-1-(2,5-dimethoxyphenyl)ethanol. InChIKey: FOEBAVBMMWYLTA-SSDOTTSWSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (1R)-1-(2,5-dimethoxyphenyl)ethanol |
| InChIKey | FOEBAVBMMWYLTA-SSDOTTSWSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)OC)OC)O |
Computed by PubChem (NCBI)