CAS 156713-10-9 appears in our catalog under these names: (1S)-1-(2,5-Dimethoxyphenyl)ethan-1-ol, 95%, (1S)-1-(2,5-Dimethoxyphenyl)ethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(1S)-1-(2,5-dimethoxyphenyl)ethanol (CAS 156713-10-9) is a chemical compound with the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. IUPAC name: (1S)-1-(2,5-dimethoxyphenyl)ethanol. InChIKey: FOEBAVBMMWYLTA-ZETCQYMHSA-N.
| Molecular formula | C10H14O3 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | (1S)-1-(2,5-dimethoxyphenyl)ethanol |
| InChIKey | FOEBAVBMMWYLTA-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1)OC)OC)O |
Computed by PubChem (NCBI)