CAS 120546-70-5 is the registry number for Thiazolo(5,4-H)isoquinolin-2(1H)-one. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g.
1H-[1,3]thiazolo[5,4-h]isoquinolin-2-one (CAS 120546-70-5) is a chemical compound with the molecular formula C10H6N2OS and a molecular weight of 202.23 g/mol. IUPAC name: 1H-[1,3]thiazolo[5,4-h]isoquinolin-2-one. InChIKey: OESRPZVDCPNWTK-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 1H-[1,3]thiazolo[5,4-h]isoquinolin-2-one |
| InChIKey | OESRPZVDCPNWTK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CN=C3)NC(=O)S2 |
Computed by PubChem (NCBI)