CAS 56304-76-8 is the registry number for 2-Oxo-6-(thiophen-2-yl)-1,2-dihydropyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile (CAS 56304-76-8) is a chemical compound with the molecular formula C10H6N2OS and a molecular weight of 202.23 g/mol. IUPAC name: 2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile. InChIKey: JTXFPILITXFNSM-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-oxo-6-thiophen-2-yl-1H-pyridine-3-carbonitrile |
| InChIKey | JTXFPILITXFNSM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C(=O)N2)C#N |
Computed by PubChem (NCBI)