CAS 62208-70-2 is the registry number for Benzofuro[3,2-d]pyrimidine-4-thiol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-[1]benzofuro[3,2-d]pyrimidine-4-thione (CAS 62208-70-2) is a chemical compound with the molecular formula C10H6N2OS and a molecular weight of 202.23 g/mol. IUPAC name: 1H-[1]benzofuro[3,2-d]pyrimidine-4-thione. InChIKey: BEYGQMGDXGLAGW-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 1H-[1]benzofuro[3,2-d]pyrimidine-4-thione |
| InChIKey | BEYGQMGDXGLAGW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=S)N=CN3 |
Computed by PubChem (NCBI)