CAS 18774-49-7 is the registry number for Benzo(4,5)thieno(2,3-D)pyrimidin-4(3H)-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CAS 18774-49-7) is a chemical compound with the molecular formula C10H6N2OS and a molecular weight of 202.23 g/mol. IUPAC name: 3H-[1]benzothiolo[2,3-d]pyrimidin-4-one. InChIKey: UELJJSQADCDBMU-UHFFFAOYSA-N.
| Molecular formula | C10H6N2OS |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChIKey | UELJJSQADCDBMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)N=CNC3=O |
Computed by PubChem (NCBI)