Products 1205548-01-1
CAS 1205548-01-1 is the registry number for 4-(Dimethylamino)benzoic Acid 6-Acetyl-2,3-dimethoxyphenyl Ester. Offered by: TRC. Available pack sizes: 100mg, 1g.
(6-acetyl-2,3-dimethoxyphenyl) 4-(dimethylamino)benzoate (CAS 1205548-01-1) is a chemical compound with the molecular formula C19H21NO5 and a molecular weight of 343.4 g/mol. IUPAC name: (6-acetyl-2,3-dimethoxyphenyl) 4-(dimethylamino)benzoate. InChIKey: GKAMOVUCTDWATB-UHFFFAOYSA-N.
| Molecular formula | C19H21NO5 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (6-acetyl-2,3-dimethoxyphenyl) 4-(dimethylamino)benzoate |
| InChIKey | GKAMOVUCTDWATB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)OC)OC)OC(=O)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)