CAS 16597-50-5 appears in our catalog under these names: Z–Thr–OBzl, Z-L-Thr-OBzl, N-Carbobenzoxy-L-threonine Benzyl Ester, >98.0%(HPLC)(N), N-[(Phenylmethoxy)carbonyl]-L-threonine phenylmethyl ester, 98%, 98%, Z-Thr-OBzl, 96%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Benzyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 16597-50-5) is a chemical compound with the molecular formula C19H21NO5 and a molecular weight of 343.4 g/mol. IUPAC name: benzyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: VBKUVUJWFDXTMS-PBHICJAKSA-N.
| Molecular formula | C19H21NO5 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | benzyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | VBKUVUJWFDXTMS-PBHICJAKSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)