CAS 3482-37-9 appears in our catalog under these names: N-Deacetyl 10-Demethyl Colchicine, N-Deacetyl Colchiceine, >95% (HPLC), Trimethylcolchicinic acid. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, 500mg, 50mg, Get quote.
(7S)-7-amino-10-hydroxy-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one (CAS 3482-37-9) is a chemical compound with the molecular formula C19H21NO5 and a molecular weight of 343.4 g/mol. IUPAC name: (7S)-7-amino-10-hydroxy-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one. InChIKey: IRVWPZRYDQROLU-ZDUSSCGKSA-N.
| Molecular formula | C19H21NO5 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (7S)-7-amino-10-hydroxy-1,2,3-trimethoxy-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| InChIKey | IRVWPZRYDQROLU-ZDUSSCGKSA-N |
| SMILES | COC1=C(C(=C2C(=C1)CC[C@@H](C3=CC(=O)C(=CC=C32)O)N)OC)OC |
Computed by PubChem (NCBI)