CAS 69863-36-1 appears in our catalog under these names: Z–Thr(Bzl)–OH, Z-L-Thr(Bzl)-OH, Z-Thr(Bzl)-OH, 98%, 98%, Z-Thr(Bzl)-OH, 98.94%, Z-Thr(Bzl)-OH, 98%. Offered by: GLPBio, Iris Biotech, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 500mg, 5g, 25g, 5 g, 25 g, 10 g, 100 g.
(2S,3R)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 69863-36-1) is a chemical compound with the molecular formula C19H21NO5 and a molecular weight of 343.4 g/mol. IUPAC name: (2S,3R)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FVKJXAYBJIAXAU-PBHICJAKSA-N.
| Molecular formula | C19H21NO5 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | (2S,3R)-3-phenylmethoxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FVKJXAYBJIAXAU-PBHICJAKSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)