CAS 120571-59-7 appears in our catalog under these names: Boc,bzl-d-ala-oh, 98%, (R)-2-(Benzyl(tert-butoxycarbonyl)amino)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 120571-59-7) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: MYGPVQDUOSMACR-LLVKDONJSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | MYGPVQDUOSMACR-LLVKDONJSA-N |
| SMILES | C[C@H](C(=O)O)N(CC1=CC=CC=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)