CAS 1206124-13-1 appears in our catalog under these names: Ethyl 2-(7-hydroxy-1h,2h,3h,4h-cyclopenta[b]indol-3-yl)acetate, 95%, Etrasimod Impurity 5, ethyl 2-{7-hydroxy-1H,2H,3H,4H-cyclopenta[b]indol-3-yl}acetate 97%, Ethyl 2-{7-hydroxy-1H,2H,3H,4H-cyclopenta[b]indol-3-yl}acetate, 97%, 97%, Ethyl 2-{7-hydroxy-1H,2H,3H,4H-cyclopenta[b]indol-3-yl}acetate, 97%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, on request, 5g, 10g, 25g, 100g.
Ethyl 2-(7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetate (CAS 1206124-13-1) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl 2-(7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetate. InChIKey: QPXXHQCMPZUYDB-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl 2-(7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetate |
| InChIKey | QPXXHQCMPZUYDB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCC2=C1NC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)