CAS 1539112-22-5 appears in our catalog under these names: 5-(4-Isopropyl-2-methoxyphenyl)-1h-pyrrole-2-carboxylic acid, 95%, 5–(4–Isopropyl–2–methoxyphenyl)–1H–pyrrole–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 250mg, 1g, 100mg.
5-(2-methoxy-4-propan-2-ylphenyl)-1H-pyrrole-2-carboxylic acid (CAS 1539112-22-5) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: 5-(2-methoxy-4-propan-2-ylphenyl)-1H-pyrrole-2-carboxylic acid. InChIKey: AEXNQFCJOOCUEL-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 5-(2-methoxy-4-propan-2-ylphenyl)-1H-pyrrole-2-carboxylic acid |
| InChIKey | AEXNQFCJOOCUEL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)C2=CC=C(N2)C(=O)O)OC |
Computed by PubChem (NCBI)