CAS 1270730-42-1 appears in our catalog under these names: 6-tert-Butyl-4-oxo-1,4-dihydro-quinoline-2-carboxylic acid methyl ester, 97%, 6-tert-Butyl-4-hydroxy-quinoline-2-carboxylic acid methyl ester, 95%, Methyl 6-(tert-butyl)-4-oxo-1,4-dihydroquinoline-2-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.
Methyl 6-tert-butyl-4-oxo-1H-quinoline-2-carboxylate (CAS 1270730-42-1) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: methyl 6-tert-butyl-4-oxo-1H-quinoline-2-carboxylate. InChIKey: DBWGCTPAMOGCEU-UHFFFAOYSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | methyl 6-tert-butyl-4-oxo-1H-quinoline-2-carboxylate |
| InChIKey | DBWGCTPAMOGCEU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)NC(=CC2=O)C(=O)OC |
Computed by PubChem (NCBI)