CAS 2227197-48-8 is the registry number for Ethyl (S)-2-(7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[(3S)-7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetate (CAS 2227197-48-8) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: ethyl 2-[(3S)-7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetate. InChIKey: QPXXHQCMPZUYDB-VIFPVBQESA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | ethyl 2-[(3S)-7-hydroxy-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl]acetate |
| InChIKey | QPXXHQCMPZUYDB-VIFPVBQESA-N |
| SMILES | CCOC(=O)C[C@@H]1CCC2=C1NC3=C2C=C(C=C3)O |
Computed by PubChem (NCBI)