Products 1206153-61-8
CAS 1206153-61-8 is the registry number for 1-(4,6-Dimethylpyrimidin-2-yl)-4-(2-hydroxyethyl)-5-oxo-2,5-dihydro-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 250mg, 5g.
2-(4,6-dimethylpyrimidin-2-yl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid (CAS 1206153-61-8) is a chemical compound with the molecular formula C12H14N4O4 and a molecular weight of 278.26 g/mol. IUPAC name: 2-(4,6-dimethylpyrimidin-2-yl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid. InChIKey: ONRRAUZLIKBFLA-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | 2-(4,6-dimethylpyrimidin-2-yl)-4-(2-hydroxyethyl)-3-oxo-1H-pyrazole-5-carboxylic acid |
| InChIKey | ONRRAUZLIKBFLA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N2C(=O)C(=C(N2)C(=O)O)CCO)C |
Computed by PubChem (NCBI)