Products 1058181-49-9

CAS 1058181-49-9 is the registry number for 3,3'-(1H,1'H-[2,2'-Biimidazole]-1,1'-diyl)dipropionic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[2-[1-(2-carboxyethyl)imidazol-2-yl]imidazol-1-yl]propanoic acid (CAS 1058181-49-9) is a chemical compound with the molecular formula C12H14N4O4 and a molecular weight of 278.26 g/mol. IUPAC name: 3-[2-[1-(2-carboxyethyl)imidazol-2-yl]imidazol-1-yl]propanoic acid. InChIKey: NSQQJWHKXHDLEA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N4O4
Molecular weight278.26 g/mol
IUPAC name3-[2-[1-(2-carboxyethyl)imidazol-2-yl]imidazol-1-yl]propanoic acid
InChIKeyNSQQJWHKXHDLEA-UHFFFAOYSA-N
SMILESC1=CN(C(=N1)C2=NC=CN2CCC(=O)O)CCC(=O)O

Computed by PubChem (NCBI)