Products 1932657-23-2
CAS 1932657-23-2 is the registry number for Z-L-Dbu(N3)-OH. Offered by: Iris Biotech, MedChemExpress. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg, Get quote.
(3S)-4-azido-3-(phenylmethoxycarbonylamino)butanoic acid (CAS 1932657-23-2) is a chemical compound with the molecular formula C12H14N4O4 and a molecular weight of 278.26 g/mol. IUPAC name: (3S)-4-azido-3-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: YHBFMNJJEQRLIV-JTQLQIEISA-N.
| Molecular formula | C12H14N4O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (3S)-4-azido-3-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | YHBFMNJJEQRLIV-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC(=O)O)CN=[N+]=[N-] |
Computed by PubChem (NCBI)