CAS 1263047-43-3 appears in our catalog under these names: Z-L-Aha-OH*DCHA, Z-L-Aha-OH. Offered by: Creative Peptides, MedChemExpress, Iris Biotech. Available pack sizes: 1g, 5g, Get quote, 250mg.
(2S)-4-azido-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 1263047-43-3) is a chemical compound with the molecular formula C12H14N4O4 and a molecular weight of 278.26 g/mol. IUPAC name: (2S)-4-azido-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: SUJMFLJVDMBGEB-JTQLQIEISA-N.
| Molecular formula | C12H14N4O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | (2S)-4-azido-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | SUJMFLJVDMBGEB-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)