Products 130676-58-3
CAS 130676-58-3 is the registry number for 5'-O-Acetyl-2',3'-dideoxyinosine. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
[(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate (CAS 130676-58-3) is a chemical compound with the molecular formula C12H14N4O4 and a molecular weight of 278.26 g/mol. IUPAC name: [(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate. InChIKey: MVUMVNRFAFXMSZ-DTWKUNHWSA-N.
| Molecular formula | C12H14N4O4 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | [(2S,5R)-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methyl acetate |
| InChIKey | MVUMVNRFAFXMSZ-DTWKUNHWSA-N |
| SMILES | CC(=O)OC[C@@H]1CC[C@@H](O1)N2C=NC3=C2N=CNC3=O |
Computed by PubChem (NCBI)
Synonyms:
Didanosine acetate, ddI-5'-Ac, 5'-Acetyl-2',3'-dideoxyinosine, DIDANOSINE ACETATE [WHO-IP], DIDANOSINE IMPURITY J [WHO-IP], Inosine, 2',3'-dideoxy-, 5'-acetate, DIDANOSINE IMPURITY J, 5'-O-Acetyl-2',3'-dideoxyinosine, [(2S,5R)-5-(6-oxo-3H-purin-9-yl)oxolan-2-yl]methyl acetate, Inosine, 2',3'-dideoxy-, 5'-acetate (9CI)