Products 1206593-30-7
CAS 1206593-30-7 is the registry number for 4-Ethoxy-3-(trifluoromethyl)benzyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-(bromomethyl)-1-ethoxy-2-(trifluoromethyl)benzene (CAS 1206593-30-7) is a chemical compound with the molecular formula C10H10BrF3O and a molecular weight of 283.08 g/mol. IUPAC name: 4-(bromomethyl)-1-ethoxy-2-(trifluoromethyl)benzene. InChIKey: GAZKSECNCUGHQP-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 4-(bromomethyl)-1-ethoxy-2-(trifluoromethyl)benzene |
| InChIKey | GAZKSECNCUGHQP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)CBr)C(F)(F)F |
Computed by PubChem (NCBI)