Products 2504202-89-3
CAS 2504202-89-3 is the registry number for 1-Bromo-2-ethyl-4-(2,2,2-trifluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-2-ethyl-4-(2,2,2-trifluoroethoxy)benzene (CAS 2504202-89-3) is a chemical compound with the molecular formula C10H10BrF3O and a molecular weight of 283.08 g/mol. IUPAC name: 1-bromo-2-ethyl-4-(2,2,2-trifluoroethoxy)benzene. InChIKey: ATWAFRJJWNBKQO-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 1-bromo-2-ethyl-4-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | ATWAFRJJWNBKQO-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)OCC(F)(F)F)Br |
Computed by PubChem (NCBI)