CAS 1365272-44-1 is the registry number for 1-Bromo-2-propoxy-4-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-2-propoxy-4-(trifluoromethyl)benzene (CAS 1365272-44-1) is a chemical compound with the molecular formula C10H10BrF3O and a molecular weight of 283.08 g/mol. IUPAC name: 1-bromo-2-propoxy-4-(trifluoromethyl)benzene. InChIKey: HZIDADXIRKHZBY-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 1-bromo-2-propoxy-4-(trifluoromethyl)benzene |
| InChIKey | HZIDADXIRKHZBY-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)