Products 1431329-69-9
CAS 1431329-69-9 appears in our catalog under these names: 4-Methoxy-3-methyl-5-(trifluoromethyl)benzyl bromide, 95%, 5-(Bromomethyl)-2-methoxy-1-methyl-3-(trifluoromethyl)benzene, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g, 10g.
5-(bromomethyl)-2-methoxy-1-methyl-3-(trifluoromethyl)benzene (CAS 1431329-69-9) is a chemical compound with the molecular formula C10H10BrF3O and a molecular weight of 283.08 g/mol. IUPAC name: 5-(bromomethyl)-2-methoxy-1-methyl-3-(trifluoromethyl)benzene. InChIKey: JKXBKNDMQOOWQU-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O |
|---|---|
| Molecular weight | 283.08 g/mol |
| IUPAC name | 5-(bromomethyl)-2-methoxy-1-methyl-3-(trifluoromethyl)benzene |
| InChIKey | JKXBKNDMQOOWQU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC)C(F)(F)F)CBr |
Computed by PubChem (NCBI)