Products 1206631-87-9
CAS 1206631-87-9 appears in our catalog under these names: Methyl 2-(4-chlorophenyl)-2-fluoroacetate, 97%, Methyl 2–(4–chlorophenyl)–2–fluoroacetate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 5g, 1g.
Methyl 2-(4-chlorophenyl)-2-fluoroacetate (CAS 1206631-87-9) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: methyl 2-(4-chlorophenyl)-2-fluoroacetate. InChIKey: WBYZDWWQWYDDKZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | methyl 2-(4-chlorophenyl)-2-fluoroacetate |
| InChIKey | WBYZDWWQWYDDKZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=C(C=C1)Cl)F |
Computed by PubChem (NCBI)