Products 1206894-79-2
CAS 1206894-79-2 is the registry number for 3-(5-Hydroxy-1,2,4-oxadiazol-3-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzoic acid (CAS 1206894-79-2) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzoic acid. InChIKey: GONPIMOBFQZFNS-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)benzoic acid |
| InChIKey | GONPIMOBFQZFNS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NOC(=O)N2 |
Computed by PubChem (NCBI)