CAS 1206969-15-4 is the registry number for 2-Chloro-5h-chromeno[4,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-chloro-5H-chromeno[4,3-d]pyrimidine (CAS 1206969-15-4) is a chemical compound with the molecular formula C11H7ClN2O and a molecular weight of 218.64 g/mol. IUPAC name: 2-chloro-5H-chromeno[4,3-d]pyrimidine. InChIKey: SHAGHWRFUMBZPX-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O |
|---|---|
| Molecular weight | 218.64 g/mol |
| IUPAC name | 2-chloro-5H-chromeno[4,3-d]pyrimidine |
| InChIKey | SHAGHWRFUMBZPX-UHFFFAOYSA-N |
| SMILES | C1C2=CN=C(N=C2C3=CC=CC=C3O1)Cl |
Computed by PubChem (NCBI)