CAS 4375-00-2 appears in our catalog under these names: Biotin Impurity 17 (Epibiotin), 6-epi-Biotin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid (CAS 4375-00-2) is a chemical compound with the molecular formula C10H16N2O3S and a molecular weight of 244.31 g/mol. IUPAC name: 5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid. InChIKey: YBJHBAHKTGYVGT-OOZYFLPDSA-N.
| Molecular formula | C10H16N2O3S |
|---|---|
| Molecular weight | 244.31 g/mol |
| IUPAC name | 5-[(3aS,4R,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid |
| InChIKey | YBJHBAHKTGYVGT-OOZYFLPDSA-N |
| SMILES | C1[C@H]2[C@@H]([C@H](S1)CCCCC(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)