Products 1206969-85-8

CAS 1206969-85-8 is the registry number for 2-Benzyl-1-oxo-2,5-diaza-spiro[3.5]nonane-5-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-benzyl-3-oxo-2,5-diazaspiro[3.5]nonane-5-carboxylate (CAS 1206969-85-8) is a chemical compound with the molecular formula C19H26N2O3 and a molecular weight of 330.4 g/mol. IUPAC name: tert-butyl 2-benzyl-3-oxo-2,5-diazaspiro[3.5]nonane-5-carboxylate. InChIKey: IHZUBPJTJLKILS-UHFFFAOYSA-N.

Identity
Molecular formulaC19H26N2O3
Molecular weight330.4 g/mol
IUPAC nametert-butyl 2-benzyl-3-oxo-2,5-diazaspiro[3.5]nonane-5-carboxylate
InChIKeyIHZUBPJTJLKILS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC12CN(C2=O)CC3=CC=CC=C3

Computed by PubChem (NCBI)