CAS 1252656-29-3 is the registry number for 1-[4-(2-tert-Butylphenyl)piperazin-1-yl]carbonylcyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid (CAS 1252656-29-3) is a chemical compound with the molecular formula C19H26N2O3 and a molecular weight of 330.4 g/mol. IUPAC name: 1-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid. InChIKey: DDCFJEHFXGGYIG-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 1-[4-(2-tert-butylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid |
| InChIKey | DDCFJEHFXGGYIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1N2CCN(CC2)C(=O)C3(CC3)C(=O)O |
Computed by PubChem (NCBI)