CAS 1341040-12-7 is the registry number for 2,7-Diazaspiro[4.5]decane-7-carboxylic acid, 1-oxo-4-phenyl-, 1,1-dimethylethyl ester, (4R,5S)-rel-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4S,5R)-1-oxo-4-phenyl-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS 1341040-12-7) is a chemical compound with the molecular formula C19H26N2O3 and a molecular weight of 330.4 g/mol. IUPAC name: tert-butyl (4S,5R)-1-oxo-4-phenyl-2,9-diazaspiro[4.5]decane-9-carboxylate. InChIKey: GDHZDHBRAYWWBH-KXBFYZLASA-N.
| Molecular formula | C19H26N2O3 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | tert-butyl (4S,5R)-1-oxo-4-phenyl-2,9-diazaspiro[4.5]decane-9-carboxylate |
| InChIKey | GDHZDHBRAYWWBH-KXBFYZLASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]2(C1)[C@@H](CNC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)