Products 1951430-54-8

CAS 1951430-54-8 is the registry number for (1R)-[2-(4-Cyano-benzyloxy)-cyclohexyl]-carbamic acid tert-butyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(1R)-2-[(4-cyanophenyl)methoxy]cyclohexyl]carbamate (CAS 1951430-54-8) is a chemical compound with the molecular formula C19H26N2O3 and a molecular weight of 330.4 g/mol. IUPAC name: tert-butyl N-[(1R)-2-[(4-cyanophenyl)methoxy]cyclohexyl]carbamate. InChIKey: GFAPGVAJPAFWOK-TZHYSIJRSA-N.

Identity
Molecular formulaC19H26N2O3
Molecular weight330.4 g/mol
IUPAC nametert-butyl N-[(1R)-2-[(4-cyanophenyl)methoxy]cyclohexyl]carbamate
InChIKeyGFAPGVAJPAFWOK-TZHYSIJRSA-N
SMILESCC(C)(C)OC(=O)N[C@@H]1CCCCC1OCC2=CC=C(C=C2)C#N

Computed by PubChem (NCBI)