CAS 1206978-90-6 appears in our catalog under these names: 7-Bromo-2-(trifluoromethyl)imidazo(1,2-a)pyridine, 98%, 7-Bromo-2-(trifluoromethyl)imidazo(1,2-a)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
7-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 1206978-90-6) is a chemical compound with the molecular formula C8H4BrF3N2 and a molecular weight of 265.03 g/mol. IUPAC name: 7-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: YYTBJGAADACPQG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3N2 |
|---|---|
| Molecular weight | 265.03 g/mol |
| IUPAC name | 7-bromo-2-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | YYTBJGAADACPQG-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)