Products 1206980-91-7
CAS 1206980-91-7 is the registry number for (2-(4-Chlorophenyl)-1,3-thiazol-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2-(4-chlorophenyl)-1,3-thiazol-5-yl]methanamine (CAS 1206980-91-7) is a chemical compound with the molecular formula C10H9ClN2S and a molecular weight of 224.71 g/mol. IUPAC name: [2-(4-chlorophenyl)-1,3-thiazol-5-yl]methanamine. InChIKey: CECCVDJSQZBWTQ-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2S |
|---|---|
| Molecular weight | 224.71 g/mol |
| IUPAC name | [2-(4-chlorophenyl)-1,3-thiazol-5-yl]methanamine |
| InChIKey | CECCVDJSQZBWTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(S2)CN)Cl |
Computed by PubChem (NCBI)