CAS 120713-59-9 appears in our catalog under these names: 3-Ethyl-5-hydroxy-1,3-dimethyl-2,3-dihydro-1h-indol-2-one, 95%, 3-Ethyl-5-hydroxy-1,3-dimethylindolin-2-one, 95+%, 3–Ethyl–5–Hydroxy–1,3–Dimethyl–2,3–Dihydro–1H–Indol–2–One. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
3-ethyl-5-hydroxy-1,3-dimethylindol-2-one (CAS 120713-59-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-ethyl-5-hydroxy-1,3-dimethylindol-2-one. InChIKey: HXTZVERNCJVVLU-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 3-ethyl-5-hydroxy-1,3-dimethylindol-2-one |
| InChIKey | HXTZVERNCJVVLU-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(C=CC(=C2)O)N(C1=O)C)C |
Computed by PubChem (NCBI)