CAS 1207282-59-4 appears in our catalog under these names: Rel-4-(((2S,3S)-1-methyl-2-(pyridin-3-yl)pyrrolidin-3-yl)methoxy)-4-oxobutanoic acid, 98%, rac-trans 3’-Hydroxymethylnicotine Hemisuccinate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
4-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methoxy]-4-oxobutanoic acid (CAS 1207282-59-4) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: 4-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methoxy]-4-oxobutanoic acid. InChIKey: CQTKSOUZGGAJEJ-IUODEOHRSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 4-[[(2S,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methoxy]-4-oxobutanoic acid |
| InChIKey | CQTKSOUZGGAJEJ-IUODEOHRSA-N |
| SMILES | CN1CC[C@@H]([C@H]1C2=CN=CC=C2)COC(=O)CCC(=O)O |
Computed by PubChem (NCBI)