Products 1207282-75-4
CAS 1207282-75-4 appears in our catalog under these names: Folic Acid-13C5, Folic Acid-13C5, >95% (HPLC), Folic acid-13C5, 95.0%. Offered by: Chemat Brand, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 0,5mg, 5mg, 1mg, 500 μg, 1 mg.
2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioic acid (CAS 1207282-75-4) is a chemical compound with the molecular formula C19H19N7O6 and a molecular weight of 446.36 g/mol. IUPAC name: 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioic acid. InChIKey: OVBPIULPVIDEAO-BCTWCYHZSA-N.
| Molecular formula | C19H19N7O6 |
|---|---|
| Molecular weight | 446.36 g/mol |
| IUPAC name | 2-[[4-[(2-amino-4-oxo-3H-pteridin-6-yl)methylamino]benzoyl]amino](1,2,3,4,5-13C5)pentanedioic acid |
| InChIKey | OVBPIULPVIDEAO-BCTWCYHZSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N[13CH]([13CH2][13CH2][13C](=O)O)[13C](=O)O)NCC2=CN=C3C(=N2)C(=O)NC(=N3)N |
Computed by PubChem (NCBI)