CAS 857398-03-9 is the registry number for 2,4-Diamino-6-((p-((1,3-dicarboxypropyl)carbamoyl)phenoxy)methyl)-pteridine. Offered by: TRC. Available pack sizes: 250mg.
2-[[4-[(2,4-diaminopteridin-6-yl)methoxy]benzoyl]amino]pentanedioic acid (CAS 857398-03-9) is a chemical compound with the molecular formula C19H19N7O6 and a molecular weight of 441.4 g/mol. IUPAC name: 2-[[4-[(2,4-diaminopteridin-6-yl)methoxy]benzoyl]amino]pentanedioic acid. InChIKey: OXQRBFXBEFIQLR-UHFFFAOYSA-N.
| Molecular formula | C19H19N7O6 |
|---|---|
| Molecular weight | 441.4 g/mol |
| IUPAC name | 2-[[4-[(2,4-diaminopteridin-6-yl)methoxy]benzoyl]amino]pentanedioic acid |
| InChIKey | OXQRBFXBEFIQLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)OCC2=CN=C3C(=N2)C(=NC(=N3)N)N |
Computed by PubChem (NCBI)